EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O6S |
| Net Charge | 0 |
| Average Mass | 419.459 |
| Monoisotopic Mass | 419.11511 |
| SMILES | Cc1cc2n(c1)S(=O)(=O)c1ccc(C(=O)NCC[C@H]3COCCO3)cc1NC2=O |
| InChI | InChI=1S/C19H21N3O6S/c1-12-8-16-19(24)21-15-9-13(2-3-17(15)29(25,26)22(16)10-12)18(23)20-5-4-14-11-27-6-7-28-14/h2-3,8-10,14H,4-7,11H2,1H3,(H,20,23)(H,21,24)/t14-/m0/s1 |
| InChIKey | OXJNOWPZKFUKNS-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neracorvir (CHEBI:759178) has role antiviral agent (CHEBI:22587) |
| neracorvir (CHEBI:759178) is a aromatic amide (CHEBI:62733) |
| neracorvir (CHEBI:759178) is a heteroarene (CHEBI:33833) |
| INN | Source |
|---|---|
| neracorvir | WHO MedNet |