EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClF3N5O2 |
| Net Charge | 0 |
| Average Mass | 465.863 |
| Monoisotopic Mass | 465.11794 |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC(F)F |
| InChI | InChI=1S/C21H19ClF3N5O2/c1-30(2)7-3-4-19(31)29-17-9-13-16(10-18(17)32-21(24)25)26-11-27-20(13)28-12-5-6-15(23)14(22)8-12/h3-6,8-11,21H,7H2,1-2H3,(H,29,31)(H,26,27,28)/b4-3+ |
| InChIKey | QPACRWFSFWQNOZ-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mifanertinib (CHEBI:759176) has role antineoplastic agent (CHEBI:35610) |
| mifanertinib (CHEBI:759176) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| mifanertinib | WHO MedNet |