EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759172 - gumelutamide
| Formula | C22H21ClN6O |
| Net Charge | 0 |
| Average Mass | 420.904 |
| Monoisotopic Mass | 420.14654 |
| SMILES | CC(C)(O)c1ccc(Nc2ncnc3c2CCN(c2ccc(C#N)c(Cl)c2)C3)nc1 |
| InChI | InChI=1S/C22H21ClN6O/c1-22(2,30)15-4-6-20(25-11-15)28-21-17-7-8-29(12-19(17)26-13-27-21)16-5-3-14(10-24)18(23)9-16/h3-6,9,11,13,30H,7-8,12H2,1-2H3,(H,25,26,27,28) |
| InChIKey | TYOPGJVWUJIKHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gumelutamide (CHEBI:759172) has role antineoplastic agent (CHEBI:35610) |
| gumelutamide (CHEBI:759172) is a benzenes (CHEBI:22712) |
| gumelutamide (CHEBI:759172) is a nitrile (CHEBI:18379) |
| INNs | Source |
|---|---|
| gumelutamida | WHO MedNet |
| gumelutamide | WHO MedNet |