EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30ClFN6O4 |
| Net Charge | 0 |
| Average Mass | 617.081 |
| Monoisotopic Mass | 616.20011 |
| SMILES | [H][C@]12CN(C(=O)C=C)CCN1c1c(c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4c(O)cccc4F)c(Cl)cc13)N(C)C2=O |
| InChI | InChI=1S/C32H30ClFN6O4/c1-6-23(42)38-12-13-39-21(15-38)31(43)37(5)29-28(39)18-14-19(33)26(24-20(34)8-7-9-22(24)41)36-30(18)40(32(29)44)27-17(4)10-11-35-25(27)16(2)3/h6-11,14,16,21,41H,1,12-13,15H2,2-5H3/t21-/m1/s1 |
| InChIKey | PYKBFRQMXJWLGG-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fulzerasib (CHEBI:759169) has role antineoplastic agent (CHEBI:35610) |
| fulzerasib (CHEBI:759169) is a naphthyridine derivative (CHEBI:73539) |
| INN | Source |
|---|---|
| fulzerasib | WHO MedNet |