EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15F3N6O |
| Net Charge | 0 |
| Average Mass | 376.342 |
| Monoisotopic Mass | 376.12594 |
| SMILES | NC(=O)c1c(N)nn2ccc(N3C[C@@H](F)C[C@@H]3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C17H15F3N6O/c18-8-1-2-11(20)10(5-8)12-6-9(19)7-25(12)13-3-4-26-17(23-13)14(16(22)27)15(21)24-26/h1-5,9,12H,6-7H2,(H2,21,24)(H2,22,27)/t9-,12+/m0/s1 |
| InChIKey | YFTARXQOKASKBW-JOYOIKCWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emzeltrectinib (CHEBI:759164) has role antineoplastic agent (CHEBI:35610) |
| emzeltrectinib (CHEBI:759164) is a pyrrolidines (CHEBI:38260) |
| INN | Source |
|---|---|
| emzeltrectinib | WHO MedNet |