EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24F2N6O |
| Net Charge | 0 |
| Average Mass | 438.482 |
| Monoisotopic Mass | 438.19797 |
| SMILES | O=C(/C=C/c1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12)N1CCNCC1 |
| InChI | InChI=1S/C23H24F2N6O/c24-17-4-5-19(25)18(14-17)20-2-1-10-30(20)21-7-11-31-23(28-21)16(15-27-31)3-6-22(32)29-12-8-26-9-13-29/h3-7,11,14-15,20,26H,1-2,8-10,12-13H2/b6-3+/t20-/m1/s1 |
| InChIKey | BQFYCHBYISNPFW-SQZHUTIHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| boditrectinib (CHEBI:759161) has role antineoplastic agent (CHEBI:35610) |
| boditrectinib (CHEBI:759161) is a pyrrolidines (CHEBI:38260) |
| INN | Source |
|---|---|
| boditrectinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AUM-601 | ChEMBL |
| AUM601 | ChEMBL |
| CHC-2014 | ChEMBL |
| CHC2014 | ChEMBL |
| HL-5101 | ChEMBL |
| HL5101 | ChEMBL |