EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32N2O6S4 |
| Net Charge | 0 |
| Average Mass | 620.840 |
| Monoisotopic Mass | 620.11432 |
| SMILES | O=C(OCCOCCOCCOC(=O)N(Cc1cccs1)Cc1cccs1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C28H32N2O6S4/c31-27(29(19-23-5-1-15-37-23)20-24-6-2-16-38-24)35-13-11-33-9-10-34-12-14-36-28(32)30(21-25-7-3-17-39-25)22-26-8-4-18-40-26/h1-8,15-18H,9-14,19-22H2 |
| InChIKey | PSBCCRKKPBQYJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alintegimod (CHEBI:759160) has role antineoplastic agent (CHEBI:35610) |
| alintegimod (CHEBI:759160) is a heteroarene (CHEBI:33833) |
| INN | Source |
|---|---|
| alintegimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| 7HP-349 | ChEMBL |
| 7HP349 | ChEMBL |