EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28FNO5 |
| Net Charge | 0 |
| Average Mass | 501.554 |
| Monoisotopic Mass | 501.19515 |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(O[C@@H]2CCc3c(-c4ccc(O[C@@H]5CCOC5)nc4)ccc(F)c32)cc1 |
| InChI | InChI=1S/C30H28FNO5/c1-2-3-20(16-29(33)34)19-4-7-22(8-5-19)36-27-12-10-25-24(9-11-26(31)30(25)27)21-6-13-28(32-17-21)37-23-14-15-35-18-23/h4-9,11,13,17,20,23,27H,10,12,14-16,18H2,1H3,(H,33,34)/t20-,23+,27+/m0/s1 |
| InChIKey | IJUWQJZOUDTENA-HRRBBWQUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xelaglifam (CHEBI:759157) has role hypoglycemic agent (CHEBI:35526) |
| xelaglifam (CHEBI:759157) is a benzenes (CHEBI:22712) |
| xelaglifam (CHEBI:759157) is a monocarboxylic acid (CHEBI:25384) |
| INN | Source |
|---|---|
| xelaglifam | WHO MedNet |
| Synonyms | Source |
|---|---|
| IDG-16177 | ChEMBL |
| IDG16177 | ChEMBL |