EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F2N5O3S |
| Net Charge | 0 |
| Average Mass | 423.445 |
| Monoisotopic Mass | 423.11767 |
| SMILES | C[C@H](Nc1ccc2c(c1)OCCn1cc(N3C(=O)SC[C@H]3C(F)F)nc1-2)C(N)=O |
| InChI | InChI=1S/C18H19F2N5O3S/c1-9(16(21)26)22-10-2-3-11-13(6-10)28-5-4-24-7-14(23-17(11)24)25-12(15(19)20)8-29-18(25)27/h2-3,6-7,9,12,15,22H,4-5,8H2,1H3,(H2,21,26)/t9-,12-/m0/s1 |
| InChIKey | KEEKMOIRJUWKNK-CABZTGNLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vulolisib (CHEBI:759156) has role antineoplastic agent (CHEBI:35610) |
| vulolisib (CHEBI:759156) is a alanine derivative (CHEBI:22278) |
| INN | Source |
|---|---|
| vulolisib | WHO MedNet |