EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31ClN6O4 |
| Net Charge | 0 |
| Average Mass | 599.091 |
| Monoisotopic Mass | 598.20953 |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C32H31ClN6O4/c1-39(2)12-5-7-31(40)38-28-15-25-27(16-30(28)43-24-10-13-41-20-24)36-18-21(17-34)32(25)37-22-8-9-29(26(33)14-22)42-19-23-6-3-4-11-35-23/h3-9,11,14-16,18,24H,10,12-13,19-20H2,1-2H3,(H,36,37)(H,38,40)/b7-5+/t24-/m0/s1 |
| InChIKey | ZGYIXVSQHOKQRZ-COIATFDQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sacibertinib (CHEBI:759150) has role antineoplastic agent (CHEBI:35610) |
| sacibertinib (CHEBI:759150) is a organochlorine compound (CHEBI:36683) |
| sacibertinib (CHEBI:759150) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| sacibertinib | WHO MedNet |