EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:759148 - povafonidine
| Formula | C11H13N5 |
| Net Charge | 0 |
| Average Mass | 215.260 |
| Monoisotopic Mass | 215.11710 |
| SMILES | Cc1c(NC2=NCCN2)ccc2ncnc12 |
| InChI | InChI=1S/C11H13N5/c1-7-8(16-11-12-4-5-13-11)2-3-9-10(7)15-6-14-9/h2-3,6H,4-5H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | KPMVPPWUQFJHCX-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| povafonidine (CHEBI:759148) is a benzimidazoles (CHEBI:22715) |
| INNs | Source |
|---|---|
| povafonidina | WHO MedNet |
| povafonidine | WHO MedNet |
| Synonyms | Source |
|---|---|
| PGE-6201204 | ChEMBL |
| PGE6201204 | ChEMBL |