EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759147 - plogosertib
| Formula | C34H48N8O3 |
| Net Charge | 0 |
| Average Mass | 616.811 |
| Monoisotopic Mass | 616.38494 |
| SMILES | COc1cc(C(=O)N[C@H]2CC[C@H](N3CCN(C)CC3)CC2)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC1(CC1)C(=O)N2C |
| InChI | InChI=1S/C34H48N8O3/c1-39-16-18-41(19-17-39)25-11-9-24(10-12-25)36-31(43)23-8-13-27(29(20-23)45-3)37-33-35-21-28-30(38-33)42(26-6-4-5-7-26)22-34(14-15-34)32(44)40(28)2/h8,13,20-21,24-26H,4-7,9-12,14-19,22H2,1-3H3,(H,36,43)(H,35,37,38)/t24-,25- |
| InChIKey | UFNLNMWVOMFWGS-SOAUALDESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plogosertib (CHEBI:759147) has role antineoplastic agent (CHEBI:35610) |
| plogosertib (CHEBI:759147) is a pyrimidodiazepine (CHEBI:39306) |
| INN | Source |
|---|---|
| plogosertib | WHO MedNet |