EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16F3N7O |
| Net Charge | 0 |
| Average Mass | 439.401 |
| Monoisotopic Mass | 439.13684 |
| SMILES | Cc1c(-c2ccnc(C(F)(F)F)c2)ncn1CC(=O)Nc1ccc(-c2cnccn2)cn1 |
| InChI | InChI=1S/C21H16F3N7O/c1-13-20(14-4-5-27-17(8-14)21(22,23)24)29-12-31(13)11-19(32)30-18-3-2-15(9-28-18)16-10-25-6-7-26-16/h2-10,12H,11H2,1H3,(H,28,30,32) |
| InChIKey | QMLOYDPILBUVBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zamaporvint (CHEBI:759142) has role antineoplastic agent (CHEBI:35610) |
| zamaporvint (CHEBI:759142) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| zamaporvint | WHO MedNet |
| Synonym | Source |
|---|---|
| Rxc 004 | ChEMBL |
| Citations |
|---|