EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19ClN6O |
| Net Charge | 0 |
| Average Mass | 394.866 |
| Monoisotopic Mass | 394.13089 |
| SMILES | Cc1nnc2c1N=C(c1ccccc1Cl)c1cnc(N3CCOCC3)cc1N2 |
| InChI | InChI=1S/C20H19ClN6O/c1-12-18-20(26-25-12)23-16-10-17(27-6-8-28-9-7-27)22-11-14(16)19(24-18)13-4-2-3-5-15(13)21/h2-5,10-11H,6-9H2,1H3,(H2,23,25,26) |
| InChIKey | DQFCVOOFMXEPOC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinengotinib (CHEBI:759141) has role antineoplastic agent (CHEBI:35610) |
| tinengotinib (CHEBI:759141) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| INN | Source |
|---|---|
| tinengotinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tt 00420 | ChEMBL |
| TT-00420 | ChEMBL |