EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H25FN4O5 |
| Net Charge | 0 |
| Average Mass | 528.540 |
| Monoisotopic Mass | 528.18090 |
| SMILES | CNC(=O)c1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)ccnc2cc1OC |
| InChI | InChI=1S/C29H25FN4O5/c1-31-26(35)22-15-21-23(16-25(22)38-2)32-14-11-24(21)39-20-9-7-19(8-10-20)34-28(37)29(12-13-29)27(36)33-18-5-3-17(30)4-6-18/h3-11,14-16H,12-13H2,1-2H3,(H,31,35)(H,33,36)(H,34,37) |
| InChIKey | JSPCKALGNNVYOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zanzalintinib (CHEBI:759139) has role antineoplastic agent (CHEBI:35610) |
| zanzalintinib (CHEBI:759139) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| zanzalintinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Xl 092 | ChEMBL |
| XL-092 | ChEMBL |
| XL092 | ChEMBL |
| Citations |
|---|