EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27ClN6O2S |
| Net Charge | 0 |
| Average Mass | 450.996 |
| Monoisotopic Mass | 450.16047 |
| SMILES | Cc1nc(N2CCC3(CC2)CO[C@@H](C)[C@H]3N)c(CO)nc1Sc1ccnc(N)c1Cl |
| InChI | InChI=1S/C20H27ClN6O2S/c1-11-19(30-14-3-6-24-17(23)15(14)21)26-13(9-28)18(25-11)27-7-4-20(5-8-27)10-29-12(2)16(20)22/h3,6,12,16,28H,4-5,7-10,22H2,1-2H3,(H2,23,24)/t12-,16+/m0/s1 |
| InChIKey | HISJAYUQVHMWTA-BLLLJJGKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vociprotafib (CHEBI:759138) has role antineoplastic agent (CHEBI:35610) |
| vociprotafib (CHEBI:759138) is a aryl sulfide (CHEBI:35683) |
| INN | Source |
|---|---|
| vociprotafib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ptpn11 inhibitor rmc-4630 | ChEMBL |
| RMC-0694630 | ChEMBL |
| Rmc 4630 | ChEMBL |
| RMC-4630 | ChEMBL |
| RMC4630 | ChEMBL |
| SAR-442720 | ChEMBL |
| Citations |
|---|