EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O6 |
| Net Charge | 0 |
| Average Mass | 386.404 |
| Monoisotopic Mass | 386.14779 |
| SMILES | O=Cc1c(O)cccc1OC[C@@H]1COCCN1C(=O)c1cccnc1CCO |
| InChI | InChI=1S/C20H22N2O6/c23-9-6-17-15(3-2-7-21-17)20(26)22-8-10-27-12-14(22)13-28-19-5-1-4-18(25)16(19)11-24/h1-5,7,11,14,23,25H,6,8-10,12-13H2/t14-/m0/s1 |
| InChIKey | NIWBSQAKKNNWBT-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osivelotor (CHEBI:759135) has role anti-anaemic agent (CHEBI:75835) |
| osivelotor (CHEBI:759135) has role renoprotective agent (CHEBI:231911) |
| osivelotor (CHEBI:759135) is a morpholines (CHEBI:38785) |
| INN | Source |
|---|---|
| osivelotor | WHO MedNet |
| Synonyms | Source |
|---|---|
| GBT-021601 | ChEMBL |
| GBT021601 | ChEMBL |
| Gbt-601 | ChEMBL |
| GBT601 | ChEMBL |
| PF-07940367 | ChEMBL |