EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N8O3 |
| Net Charge | 0 |
| Average Mass | 460.498 |
| Monoisotopic Mass | 460.19714 |
| SMILES | CNc1cc(Nc2cccn(-c3ccccn3)c2=O)nc2c(C(=O)N[C@@H]3CC[C@H]3OC)cnn12 |
| InChI | InChI=1S/C23H24N8O3/c1-24-20-12-18(27-16-6-5-11-30(23(16)33)19-7-3-4-10-25-19)29-21-14(13-26-31(20)21)22(32)28-15-8-9-17(15)34-2/h3-7,10-13,15,17,24H,8-9H2,1-2H3,(H,27,29)(H,28,32)/t15-,17-/m1/s1 |
| InChIKey | BWINBHTTZLVXGT-NVXWUHKLSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. renoprotective agent Any compound that is able to prevent damage to the kidneys. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zasocitinib (CHEBI:759134) has role anti-inflammatory agent (CHEBI:67079) |
| zasocitinib (CHEBI:759134) has role antipsoriatic (CHEBI:50748) |
| zasocitinib (CHEBI:759134) has role renoprotective agent (CHEBI:231911) |
| zasocitinib (CHEBI:759134) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| zasocitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| NDI-034858 | ChEMBL |
| NDI034858 | ChEMBL |
| TAK-279 | ChEMBL |
| TAK279 | ChEMBL |
| Citations |
|---|