EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39O4.C20H18NO4 |
| Net Charge | 0 |
| Average Mass | 727.939 |
| Monoisotopic Mass | 727.40842 |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)[O-])[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C24H40O4.C20H18NO4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26;1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28);3-4,7-10H,5-6,11H2,1-2H3/q;+1/p-1/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-;/m1./s1 |
| InChIKey | FHZVFXJRSFLYDY-FUXQPCDDSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| berberine ursodeoxycholate (CHEBI:759133) is a bile acid (CHEBI:3098) |
| INNs | Source |
|---|---|
| berberine ursodeoxycholate | WHO MedNet |
| ursodeoxycholate de berberine | WHO MedNet |
| ursodeoxycholato de berberina | WHO MedNet |
| Synonyms | Source |
|---|---|
| HTD-1801 | ChEMBL |
| HTD1801 | ChEMBL |