EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.CH4O3S.C22H23F3N4O3 |
| Net Charge | 0 |
| Average Mass | 640.659 |
| Monoisotopic Mass | 640.14846 |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Cc1c(F)c(N)c2c(=O)cc(-c3ccc(NC(=O)[C@@H](N)CCCCN)c(F)c3)oc2c1F |
| InChI | InChI=1S/C22H23F3N4O3.2CH4O3S/c1-10-18(24)20(28)17-15(30)9-16(32-21(17)19(10)25)11-5-6-14(12(23)8-11)29-22(31)13(27)4-2-3-7-26;2*1-5(2,3)4/h5-6,8-9,13H,2-4,7,26-28H2,1H3,(H,29,31);2*1H3,(H,2,3,4)/t13-;;/m0../s1 |
| InChIKey | FDQJDUBLCBZBCQ-GXKRWWSZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afp-464 (CHEBI:759129) has role antineoplastic agent (CHEBI:35610) |
| afp-464 (CHEBI:759129) is a flavonoids (CHEBI:72544) |
| Synonyms | Source |
|---|---|
| Afp 464 | ChEMBL |
| Afp-464 | ChEMBL |
| AFP464 | ChEMBL |