EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30BrN4O8P |
| Net Charge | 0 |
| Average Mass | 589.380 |
| Monoisotopic Mass | 588.09846 |
| SMILES | CCC[C@H](C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1OC[C@@H](n2ccc(N)nc2=O)O1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H30BrN4O8P/c1-4-5-14(2)33-21(28)15(3)26-36(30,35-17-8-6-16(23)7-9-17)32-13-20-31-12-19(34-20)27-11-10-18(24)25-22(27)29/h6-11,14-15,19-20H,4-5,12-13H2,1-3H3,(H,26,30)(H2,24,25,29)/t14-,15-,19-,20-,36?/m0/s1 |
| InChIKey | JBYKMODFCUCTGY-LORHTMQKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fostroxacitabine bralpamide (CHEBI:759127) has role antineoplastic agent (CHEBI:35610) |
| fostroxacitabine bralpamide (CHEBI:759127) is a α-amino acid ester (CHEBI:46874) |
| INN | Source |
|---|---|
| fostroxacitabine bralpamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Miv818 | ChEMBL |
| MIV-818 | ChEMBL |