EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21FN6O3 |
| Net Charge | 0 |
| Average Mass | 448.458 |
| Monoisotopic Mass | 448.16592 |
| SMILES | COc1cc2ncc3c(c2cc1-c1cn(C)nc1C)n(-c1c(F)cncc1OC)c(=O)n3C |
| InChI | InChI=1S/C23H21FN6O3/c1-12-15(11-28(2)27-12)13-6-14-17(7-19(13)32-4)26-9-18-21(14)30(23(31)29(18)3)22-16(24)8-25-10-20(22)33-5/h6-11H,1-5H3 |
| InChIKey | WNEFOSMCGCLLJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lartesertib (CHEBI:759126) has role antineoplastic agent (CHEBI:35610) |
| lartesertib (CHEBI:759126) is a imidazoquinoline (CHEBI:38776) |
| INN | Source |
|---|---|
| lartesertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| M 4076 | ChEMBL |
| M-4076 | ChEMBL |
| M4076 | ChEMBL |
| Citations |
|---|