EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20F3N5O3 |
| Net Charge | 0 |
| Average Mass | 447.417 |
| Monoisotopic Mass | 447.15182 |
| SMILES | CC1(C)COc2ccc(F)cc2CN2c3nc4c(cnn4cc3OC[C@H]2C(F)F)C(=O)N1 |
| InChI | InChI=1S/C21H20F3N5O3/c1-21(2)10-32-15-4-3-12(22)5-11(15)7-28-14(17(23)24)9-31-16-8-29-18(26-19(16)28)13(6-25-29)20(30)27-21/h3-6,8,14,17H,7,9-10H2,1-2H3,(H,27,30)/t14-/m0/s1 |
| InChIKey | ILAMRXVQSGVCJX-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zotizalkib (CHEBI:759125) has role antineoplastic agent (CHEBI:35610) |
| zotizalkib (CHEBI:759125) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| zotizalkib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tpx 0131 | ChEMBL |
| TPX-0131 | ChEMBL |
| TPX0131 | ChEMBL |
| Citations |
|---|