EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N6O2 |
| Net Charge | 0 |
| Average Mass | 430.512 |
| Monoisotopic Mass | 430.21172 |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)N4CCN(CC)CC4)cc23)c1 |
| InChI | InChI=1S/C24H26N6O2/c1-4-17-7-6-8-18(13-17)27-23-19-14-21(22(32-3)15-20(19)25-16-26-23)28-24(31)30-11-9-29(5-2)10-12-30/h1,6-8,13-16H,5,9-12H2,2-3H3,(H,28,31)(H,25,26,27) |
| InChIKey | DQAZPZIYEOGZAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epitinib (CHEBI:759124) has role antineoplastic agent (CHEBI:35610) |
| epitinib (CHEBI:759124) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Epitinib | ChEMBL |
| HMPL-813 | ChEMBL |