EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N6O2 |
| Net Charge | 0 |
| Average Mass | 442.523 |
| Monoisotopic Mass | 442.21172 |
| SMILES | [H][C@]12CCN(C)[C@@]1([H])CN(C(=O)Nc1cc3c(Nc4cccc(C#C)c4)ncnc3cc1OC)C2 |
| InChI | InChI=1S/C25H26N6O2/c1-4-16-6-5-7-18(10-16)28-24-19-11-21(23(33-3)12-20(19)26-15-27-24)29-25(32)31-13-17-8-9-30(2)22(17)14-31/h1,5-7,10-12,15,17,22H,8-9,13-14H2,2-3H3,(H,29,32)(H,26,27,28)/t17-,22+/m1/s1 |
| InChIKey | FSXCKIBROURMFT-VGSWGCGISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theliatinib (CHEBI:759123) has role antineoplastic agent (CHEBI:35610) |
| theliatinib (CHEBI:759123) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| xiliertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| HMPL-309 | ChEMBL |
| Theliatinib | ChEMBL |