EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29ClN6O5 |
| Net Charge | 0 |
| Average Mass | 528.997 |
| Monoisotopic Mass | 528.18880 |
| SMILES | CC(=O)N1CCN(CCOc2cc(OC(C)C)c3c(Nc4c(Cl)cnc5c4OCO5)ncnc3c2)CC1 |
| InChI | InChI=1S/C25H29ClN6O5/c1-15(2)37-20-11-17(34-9-8-31-4-6-32(7-5-31)16(3)33)10-19-21(20)24(29-13-28-19)30-22-18(26)12-27-25-23(22)35-14-36-25/h10-13,15H,4-9,14H2,1-3H3,(H,27,28,29,30) |
| InChIKey | MVWATCATLSSVBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-0424 (CHEBI:759121) has role antineoplastic agent (CHEBI:35610) |
| azd-0424 (CHEBI:759121) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Azd-0424 | ChEMBL |
| AZD0424 | ChEMBL |