EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N8O4S |
| Net Charge | 0 |
| Average Mass | 642.786 |
| Monoisotopic Mass | 642.27367 |
| SMILES | COc1ccc(C)cc1NC(=O)Nc1nc2ccc(Nc3ncnc4cc(OCCCN5CCN(C)CC5)c(OC)cc34)cc2s1 |
| InChI | InChI=1S/C33H38N8O4S/c1-21-6-9-27(43-3)26(16-21)37-32(42)39-33-38-24-8-7-22(17-30(24)46-33)36-31-23-18-28(44-4)29(19-25(23)34-20-35-31)45-15-5-10-41-13-11-40(2)12-14-41/h6-9,16-20H,5,10-15H2,1-4H3,(H,34,35,36)(H2,37,38,39,42) |
| InChIKey | MAFACRSJGNJHCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4sc-203 (CHEBI:759119) has role antineoplastic agent (CHEBI:35610) |
| 4sc-203 (CHEBI:759119) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| 4sc 203 | ChEMBL |
| 4sc-203 | ChEMBL |