EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21F2N3O |
| Net Charge | 0 |
| Average Mass | 357.404 |
| Monoisotopic Mass | 357.16527 |
| SMILES | O=C(N[C@@H]1C2CCN(CC2)[C@H]1Cc1cccnc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H21F2N3O/c21-16-9-15(10-17(22)11-16)20(26)24-19-14-3-6-25(7-4-14)18(19)8-13-2-1-5-23-12-13/h1-2,5,9-12,14,18-19H,3-4,6-8H2,(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | UAKZGMMGIMKFMV-RBUKOAKNSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tc-6987 (CHEBI:759116) has role anti-asthmatic agent (CHEBI:65023) |
| tc-6987 (CHEBI:759116) has role hypoglycemic agent (CHEBI:35526) |
| tc-6987 (CHEBI:759116) is a carbonyl compound (CHEBI:36586) |
| tc-6987 (CHEBI:759116) is a organohalogen compound (CHEBI:17792) |
| Synonym | Source |
|---|---|
| TC-6987 | ChEMBL |