EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26ClNO4S |
| Net Charge | 0 |
| Average Mass | 472.006 |
| Monoisotopic Mass | 471.12711 |
| SMILES | COc1cc2c(cc1S(=O)(=O)c1ccc(OCc3ccc(Cl)cc3)cc1)CCN(C)CC2 |
| InChI | InChI=1S/C25H26ClNO4S/c1-27-13-11-19-15-24(30-2)25(16-20(19)12-14-27)32(28,29)23-9-7-22(8-10-23)31-17-18-3-5-21(26)6-4-18/h3-10,15-16H,11-14,17H2,1-2H3 |
| InChIKey | HIBWHHQXUSKNOV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sb-773812 (CHEBI:759108) has role antipsychotic agent (CHEBI:35476) |
| sb-773812 (CHEBI:759108) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| GW773812 | ChEMBL |
| SB-737050-A | ChEMBL |
| SB-773812 | ChEMBL |