EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28FN5O |
| Net Charge | 0 |
| Average Mass | 445.542 |
| Monoisotopic Mass | 445.22779 |
| SMILES | CCN1CCC(Nc2ccc3c(c2)/C(=C(\c2cccc(F)c2)c2ncc(C)n2)C(=O)N3)CC1 |
| InChI | InChI=1S/C26H28FN5O/c1-3-32-11-9-19(10-12-32)30-20-7-8-22-21(14-20)24(26(33)31-22)23(25-28-15-16(2)29-25)17-5-4-6-18(27)13-17/h4-8,13-15,19,30H,3,9-12H2,1-2H3,(H,28,29)(H,31,33)/b24-23- |
| InChIKey | DMQYDVBIPXAAJA-VHXPQNKSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xl-999 (CHEBI:759105) has role antineoplastic agent (CHEBI:35610) |
| xl-999 (CHEBI:759105) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Xl 999 | ChEMBL |
| XL-999 | ChEMBL |