EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N5O |
| Net Charge | 0 |
| Average Mass | 321.384 |
| Monoisotopic Mass | 321.15896 |
| SMILES | CCN1CCC(Oc2c(C#N)ncc3nc4ncccc4c23)CC1 |
| InChI | InChI=1S/C18H19N5O/c1-2-23-8-5-12(6-9-23)24-17-14(10-19)21-11-15-16(17)13-4-3-7-20-18(13)22-15/h3-4,7,11-12H,2,5-6,8-9H2,1H3,(H,20,22) |
| InChIKey | XEZLBMHDUXSICI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rg-7602 (CHEBI:759103) has role antineoplastic agent (CHEBI:35610) |
| rg-7602 (CHEBI:759103) is a pyrrolopyridine (CHEBI:46771) |
| Synonyms | Source |
|---|---|
| GDC-0425 | ChEMBL |
| RG-7602 | ChEMBL |