EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O |
| Net Charge | 0 |
| Average Mass | 236.359 |
| Monoisotopic Mass | 236.18886 |
| SMILES | C[C@H](N)c1ccc([C@H](O)CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O/c1-10(15)11-5-7-12(8-6-11)13(17)9-16-14(2,3)4/h5-8,10,13,16-17H,9,15H2,1-4H3/t10-,13+/m0/s1 |
| InChIKey | KUHBBYPXWKYKKR-GXFFZTMASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-1496 (CHEBI:759102) has role antineoplastic agent (CHEBI:35610) |
| mk-1496 (CHEBI:759102) is a benzenes (CHEBI:22712) |
| Synonym | Source |
|---|---|
| Mk-1496 | ChEMBL |