EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O4 |
| Net Charge | 0 |
| Average Mass | 348.398 |
| Monoisotopic Mass | 348.13616 |
| SMILES | Cc1c(O)ccc2c1OC[C@@H](c1ccc(O)cc1)[C@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C22H20O4/c1-13-20(25)11-10-18-21(15-4-8-17(24)9-5-15)19(12-26-22(13)18)14-2-6-16(23)7-3-14/h2-11,19,21,23-25H,12H2,1H3/t19-,21-/m0/s1 |
| InChIKey | QVCAATSEPLQVBX-FPOVZHCZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| me-344 (CHEBI:759101) has role antineoplastic agent (CHEBI:35610) |
| me-344 (CHEBI:759101) is a hydroxyisoflavans (CHEBI:76250) |
| Synonyms | Source |
|---|---|
| Me 344 | ChEMBL |
| Me-344 | ChEMBL |