EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O3S.C28H29N5O3S |
| Net Charge | 0 |
| Average Mass | 687.844 |
| Monoisotopic Mass | 687.21853 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccsc1C(=O)Nc1cc(CN2CCN(C(=O)CO)CC2)ccc1/C=C/c1nnc2ccccc12 |
| InChI | InChI=1S/C28H29N5O3S.C7H8O3S/c1-19-10-15-37-27(19)28(36)29-25-16-20(17-32-11-13-33(14-12-32)26(35)18-34)6-7-21(25)8-9-24-22-4-2-3-5-23(22)30-31-24;1-6-2-4-7(5-3-6)11(8,9)10/h2-10,15-16,34H,11-14,17-18H2,1H3,(H,29,36)(H,30,31);2-5H,1H3,(H,8,9,10)/b9-8+; |
| InChIKey | SIJKXSMUXNJNQM-HRNDJLQDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kw-2450 (CHEBI:759080) has role antineoplastic agent (CHEBI:35610) |
| kw-2450 (CHEBI:759080) is a aromatic amide (CHEBI:62733) |
| Synonym | Source |
|---|---|
| KW-2450 | ChEMBL |
| Citations |
|---|