EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28Cl2N6O3 |
| Net Charge | 0 |
| Average Mass | 555.466 |
| Monoisotopic Mass | 554.15999 |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3c(NC(=O)c4ccc(N5CCNC(C)(C)C5)cc4)nnc3n2)c1Cl |
| InChI | InChI=1S/C27H28Cl2N6O3/c1-27(2)14-35(12-11-30-27)16-7-5-15(6-8-16)26(36)32-25-17-9-10-18(31-24(17)33-34-25)21-22(28)19(37-3)13-20(38-4)23(21)29/h5-10,13,30H,11-12,14H2,1-4H3,(H2,31,32,33,34,36) |
| InChIKey | QNXOYMFBIACDSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| segigratinib (CHEBI:759078) has role antineoplastic agent (CHEBI:35610) |
| segigratinib (CHEBI:759078) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| segigratinib | WHO MedNet |
| Citations |
|---|