EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22F2N4O |
| Net Charge | 0 |
| Average Mass | 456.496 |
| Monoisotopic Mass | 456.17617 |
| SMILES | N#Cc1cccc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CCC(N)CC4)c3c2)c1O |
| InChI | InChI=1S/C27H22F2N4O/c28-19-10-18(11-20(29)13-19)24-15-32-25-5-4-16(22-3-1-2-17(14-30)27(22)34)12-23(25)26(24)33-8-6-21(31)7-9-33/h1-5,10-13,15,21,34H,6-9,31H2 |
| InChIKey | GHILNKWBALQPDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paltusotine (CHEBI:759077) has role antineoplastic agent (CHEBI:35610) |
| paltusotine (CHEBI:759077) is a diarylheptanoid (CHEBI:78802) |
| INN | Source |
|---|---|
| paltusotine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CRN-00808 | ChEMBL |
| CRN00808 | ChEMBL |
| Citations |
|---|