EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759076 - rosolutamide
| Formula | C28H32O6 |
| Net Charge | 0 |
| Average Mass | 464.558 |
| Monoisotopic Mass | 464.21989 |
| SMILES | COc1ccc(/C=C/C(=O)C(CC2CCC2)C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H32O6/c1-31-25-14-10-20(17-27(25)33-3)8-12-23(29)22(16-19-6-5-7-19)24(30)13-9-21-11-15-26(32-2)28(18-21)34-4/h8-15,17-19,22H,5-7,16H2,1-4H3/b12-8+,13-9+ |
| InChIKey | PJOSHEDKRPRCAE-QHKWOANTSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosolutamide (CHEBI:759076) is a diarylheptanoid (CHEBI:78802) |
| INNs | Source |
|---|---|
| rosolutamida | WHO MedNet |
| rosolutamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| ASC-JM-17 | ChEMBL |
| ASC-JM17 | ChEMBL |
| Citations |
|---|