EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4O4S |
| Net Charge | 0 |
| Average Mass | 402.476 |
| Monoisotopic Mass | 402.13618 |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1cnn2c1OCCC2 |
| InChI | InChI=1S/C19H22N4O4S/c24-19(22-28(25,26)16-11-20-23-8-3-9-27-18(16)23)21-17-14-6-1-4-12(14)10-13-5-2-7-15(13)17/h10-11H,1-9H2,(H2,21,22,24) |
| InChIKey | KWSGPJCQWZMUQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jt-001 (CHEBI:759074) has role antiviral agent (CHEBI:22587) |
| jt-001 (CHEBI:759074) has role hypoglycemic agent (CHEBI:35526) |
| jt-001 (CHEBI:759074) is a indanes (CHEBI:46940) |
| Synonyms | Source |
|---|---|
| Jt-001 | ChEMBL |
| Jt001 | ChEMBL |
| Citations |
|---|