EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17FN8O2 |
| Net Charge | 0 |
| Average Mass | 408.397 |
| Monoisotopic Mass | 408.14585 |
| SMILES | COc1ncnn2ccc(-c3cnc4nc(C)n(Cc5nnc([C@@H](C)F)o5)c4c3)c12 |
| InChI | InChI=1S/C19H17FN8O2/c1-10(20)18-26-25-15(30-18)8-27-11(2)24-17-14(27)6-12(7-21-17)13-4-5-28-16(13)19(29-3)22-9-23-28/h4-7,9-10H,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | OENNTZBJPRRGFL-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rogocekib (CHEBI:759072) has role antineoplastic agent (CHEBI:35610) |
| rogocekib (CHEBI:759072) is a imidazopyridine (CHEBI:46908) |
| INN | Source |
|---|---|
| rogocekib | WHO MedNet |
| Citations |
|---|