EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28N6O4 |
| Net Charge | 0 |
| Average Mass | 404.471 |
| Monoisotopic Mass | 404.21720 |
| SMILES | COCc1cc(C(=O)Nc2cc([C@H]3CC[C@@H](OC(=O)NC(C)C)C3)nn2)n(C)n1 |
| InChI | InChI=1S/C19H28N6O4/c1-11(2)20-19(27)29-14-6-5-12(7-14)15-9-17(23-22-15)21-18(26)16-8-13(10-28-4)24-25(16)3/h8-9,11-12,14H,5-7,10H2,1-4H3,(H,20,27)(H2,21,22,23,26)/t12-,14+/m0/s1 |
| InChIKey | MTNBRBDFNSGQKB-GXTWGEPZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tegtociclib (CHEBI:759071) has role antineoplastic agent (CHEBI:35610) |
| tegtociclib (CHEBI:759071) is a aromatic amide (CHEBI:62733) |
| tegtociclib (CHEBI:759071) is a heteroarene (CHEBI:33833) |
| INNs | Source |
|---|---|
| tagtociclib | WHO MedNet |
| tegtociclib | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-07104091 | ChEMBL |
| Citations |
|---|