EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20FN3O5 |
| Net Charge | 0 |
| Average Mass | 365.361 |
| Monoisotopic Mass | 365.13870 |
| SMILES | COC(=O)NC[C@H]1CN(c2ccc(N3CC4(COC4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20FN3O5/c1-24-15(22)19-5-12-6-21(16(23)26-12)11-2-3-14(13(18)4-11)20-7-17(8-20)9-25-10-17/h2-4,12H,5-10H2,1H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | ZNBRXLSWXJKKLJ-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tbi-223 (CHEBI:759069) has role antitubercular agent (CHEBI:33231) |
| tbi-223 (CHEBI:759069) is a azetidines (CHEBI:38777) |
| tbi-223 (CHEBI:759069) is a benzenes (CHEBI:22712) |
| tbi-223 (CHEBI:759069) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Tbi-223 | ChEMBL |
| TBI 223 | ChEMBL |
| Citations |
|---|