EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5 |
| Net Charge | 0 |
| Average Mass | 287.411 |
| Monoisotopic Mass | 287.21100 |
| SMILES | CCC(CC)c1cc(N[C@H]2CC[C@H](N)C2)n2nccc2n1 |
| InChI | InChI=1S/C16H25N5/c1-3-11(4-2)14-10-16(19-13-6-5-12(17)9-13)21-15(20-14)7-8-18-21/h7-8,10-13,19H,3-6,9,17H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | VYKCLMALANGCDF-STQMWFEESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| istisociclib (CHEBI:759068) has role antineoplastic agent (CHEBI:35610) |
| istisociclib (CHEBI:759068) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| istisociclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| KB-00130742 | ChEMBL |
| KB-0742 | ChEMBL |
| KB0742 | ChEMBL |
| KB-130742 | ChEMBL |
| UB-18422 | ChEMBL |
| Citations |
|---|