EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N6O2S |
| Net Charge | 0 |
| Average Mass | 402.524 |
| Monoisotopic Mass | 402.18380 |
| SMILES | COc1nc(C(C)C)ccc1-c1cnc2sc(N3CCC(O)(CN)CC3)nn12 |
| InChI | InChI=1S/C19H26N6O2S/c1-12(2)14-5-4-13(16(22-14)27-3)15-10-21-17-25(15)23-18(28-17)24-8-6-19(26,11-20)7-9-24/h4-5,10,12,26H,6-9,11,20H2,1-3H3 |
| InChIKey | JYHSRMKXBAPFST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ine-963 (CHEBI:759063) has role antimalarial (CHEBI:38068) |
| ine-963 (CHEBI:759063) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| Ine-963 | ChEMBL |
| Ine963 | ChEMBL |
| Citations |
|---|