EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N.C9H13N.C9H13N |
| Net Charge | 0 |
| Average Mass | 405.630 |
| Monoisotopic Mass | 405.31440 |
| SMILES | CC(N)Cc1ccccc1.C[C@H](N)Cc1ccccc1.C[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/3C9H13N/c3*1-8(10)7-9-5-3-2-4-6-9/h3*2-6,8H,7,10H2,1H3/t2*8-;/m00./s1 |
| InChIKey | DUKHFSGXIHAISL-QXGOIDDHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amphetamine/dextroamphetamine (CHEBI:759055) is a amphetamines (CHEBI:35338) |