EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23F3N4O4 |
| Net Charge | 0 |
| Average Mass | 500.477 |
| Monoisotopic Mass | 500.16714 |
| SMILES | COc1cc2cc(-c3ccc(CC(=O)Nc4cc(C(C)(C)C(F)(F)F)no4)cn3)cnc2cc1OC |
| InChI | InChI=1S/C25H23F3N4O4/c1-24(2,25(26,27)28)21-11-23(36-32-21)31-22(33)7-14-5-6-17(29-12-14)16-8-15-9-19(34-3)20(35-4)10-18(15)30-13-16/h5-6,8-13H,7H2,1-4H3,(H,31,33) |
| InChIKey | KOLQINCWMXQEOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeteletinib (CHEBI:759053) has role antineoplastic agent (CHEBI:35610) |
| zeteletinib (CHEBI:759053) is a bipyridines (CHEBI:50511) |
| Synonyms | Source |
|---|---|
| BOS-172738 | ChEMBL |
| BOS172738 | ChEMBL |
| CAXM-1190b | ChEMBL |
| DS-5010b | ChEMBL |
| Ret inhibitor ds-5010 | ChEMBL |
| Zeteletinib | ChEMBL |