EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 284.098 |
| Monoisotopic Mass | 282.98030 |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C12H7Cl2NO3/c13-8-1-6-12(11(14)7-8)18-10-4-2-9(3-5-10)15(16)17/h1-7H |
| InChIKey | XITQUSLLOSKDTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrofen (CHEBI:7590) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| nitrofen (CHEBI:7590) has role herbicide (CHEBI:24527) |
| nitrofen (CHEBI:7590) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Nitrofen | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11065 | KEGG COMPOUND |
| 1422 | PPDB |
| HMDB0041951 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1836-75-5 | KEGG COMPOUND |