EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N3O3S |
| Net Charge | 0 |
| Average Mass | 391.537 |
| Monoisotopic Mass | 391.19296 |
| SMILES | CCN1CCC(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1 |
| InChI | InChI=1S/C20H29N3O3S/c1-2-23-11-9-16(10-12-23)27(25,26)22-20(24)21-19-17-7-3-5-14(17)13-15-6-4-8-18(15)19/h13,16H,2-12H2,1H3,(H2,21,22,24) |
| InChIKey | OHIFQOUPTWBQLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selnoflast (CHEBI:758985) has role anti-inflammatory agent (CHEBI:67079) |
| selnoflast (CHEBI:758985) has role antiparkinson drug (CHEBI:48407) |
| selnoflast (CHEBI:758985) is a piperidinesulfonamide (CHEBI:48738) |
| Synonyms | Source |
|---|---|
| RO-7486967 | ChEMBL |
| RO7486967 | ChEMBL |
| Selnoflast | ChEMBL |
| Citations |
|---|