EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C24H25N7O5 |
| Net Charge | 0 |
| Average Mass | 527.969 |
| Monoisotopic Mass | 527.16839 |
| SMILES | Cc1cc(-c2nc(C(=O)Nc3cc4oc(N5CCOCC5)nc4nc3N3CC[C@@H](O)C3)co2)ccn1.Cl |
| InChI | InChI=1S/C24H25N7O5.ClH/c1-14-10-15(2-4-25-14)23-27-18(13-35-23)22(33)26-17-11-19-20(28-21(17)31-5-3-16(32)12-31)29-24(36-19)30-6-8-34-9-7-30;/h2,4,10-11,13,16,32H,3,5-9,12H2,1H3,(H,26,33);1H/t16-;/m1./s1 |
| InChIKey | OUXHHDXWNFNMQC-PKLMIRHRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emavusertib hydrochloride (CHEBI:758983) has role antineoplastic agent (CHEBI:35610) |
| emavusertib hydrochloride (CHEBI:758983) is a oxazolopyridine (CHEBI:38765) |
| Synonyms | Source |
|---|---|
| CA-4948 hydrochloride | ChEMBL |
| Emavusertib hydrochloride | ChEMBL |