EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H63N9O15S |
| Net Charge | 0 |
| Average Mass | 1182.279 |
| Monoisotopic Mass | 1181.41643 |
| SMILES | [H][C@]12CNc3cc(OCc4cc(COc5cc6c(cc5OC)C(=O)N5c7ccccc7C[C@@]5([H])[C@H](S(=O)(=O)O)N6)cc(NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)CCCCC(=O)NCCN5C(=O)C=CC5=O)c4)c(OC)cc3C(=O)N1c1ccccc1C2 |
| InChI | InChI=1S/C60H63N9O15S/c1-33(63-53(71)16-10-9-15-52(70)61-19-20-67-54(72)17-18-55(67)73)56(74)64-34(2)57(75)65-39-22-35(31-83-50-28-43-41(26-48(50)81-3)59(76)68-40(30-62-43)24-37-11-5-7-13-45(37)68)21-36(23-39)32-84-51-29-44-42(27-49(51)82-4)60(77)69-46-14-8-6-12-38(46)25-47(69)58(66-44)85(78,79)80/h5-8,11-14,17-18,21-23,26-29,33-34,40,47,58,62,66H,9-10,15-16,19-20,24-25,30-32H2,1-4H3,(H,61,70)(H,63,71)(H,64,74)(H,65,75)(H,78,79,80)/t33-,34-,40-,47-,58-/m0/s1 |
| InChIKey | ULMLCLUWGHVNGG-ZVGXFVMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sunirine (CHEBI:758976) has role antineoplastic agent (CHEBI:35610) |
| sunirine (CHEBI:758976) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| DGN549-C | ChEMBL |
| Sunirine | ChEMBL |