EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C20H23N3O2 |
| Net Charge | 0 |
| Average Mass | 487.509 |
| Monoisotopic Mass | 487.19546 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.[H][C@@]12N(C)CC[C@]1(C)c1cc(OC(=O)Nc3ccccc3)ccc1N2C |
| InChI | InChI=1S/C20H23N3O2.C4H6O6/c1-20-11-12-22(2)18(20)23(3)17-10-9-15(13-16(17)20)25-19(24)21-14-7-5-4-6-8-14;5-1(3(7)8)2(6)4(9)10/h4-10,13,18H,11-12H2,1-3H3,(H,21,24);1-2,5-6H,(H,7,8)(H,9,10)/t18-,20+;/m0./s1 |
| InChIKey | XKKPTCVQEJZDGT-VKLKMBQZSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buntanetap tartrate (CHEBI:758974) has role antiparkinson drug (CHEBI:48407) |
| buntanetap tartrate (CHEBI:758974) is a pyrroloindole (CHEBI:48133) |
| Synonyms | Source |
|---|---|
| Buntanetap tartrate | ChEMBL |
| Posiphen tartrate | ChEMBL |
| R-phenserine tartrate | ChEMBL |